C20H22N2O6S — CID 7732178
ethyl 3-[[2-[2-(3-methylanilino)-2-oxoethyl]sulfonylacetyl]amino]benzoate (PubChem CID 7732178) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is ethyl 3-[[2-[2-(3-methylanilino)-2-oxoethyl]sulfonylacetyl]amino]benzoate.
| Compound Name | ethyl 3-[[2-[2-(3-methylanilino)-2-oxoethyl]sulfonylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7732178 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | ethyl 3-[[2-[2-(3-methylanilino)-2-oxoethyl]sulfonylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)CS(=O)(=O)CC(=O)Nc2cccc(C)c2)c1 |
| InChI | InChI=1S/C20H22N2O6S/c1-3-28-20(25)15-7-5-9-17(11-15)22-19(24)13-29(26,27)12-18(23)21-16-8-4-6-14(2)10-16/h4-11H,3,12-13H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | XRKAFWDMQFNCOJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |