C20H14FNO2 — CID 7733139
N-(4-fluorophenyl)-3-methylbenzo[g][1]benzofuran-2-carboxamide (PubChem CID 7733139) has the molecular formula C20H14FNO2 and a molecular weight of 319.34 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-methylbenzo[g][1]benzofuran-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-3-methylbenzo[g][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7733139 |
| Molecular Formula | C20H14FNO2 |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(4-fluorophenyl)-3-methylbenzo[g][1]benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ccc(F)cc2)oc2c1ccc1ccccc12 |
| InChI | InChI=1S/C20H14FNO2/c1-12-16-11-6-13-4-2-3-5-17(13)19(16)24-18(12)20(23)22-15-9-7-14(21)8-10-15/h2-11H,1H3,(H,22,23) |
| InChIKey | ZGMMALLJIUPCLG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |