C20H13Cl2NO2 — CID 7899905
N-(2,5-dichlorophenyl)-3-methylbenzo[g][1]benzofuran-2-carboxamide (PubChem CID 7899905) has the molecular formula C20H13Cl2NO2 and a molecular weight of 370.24 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-3-methylbenzo[g][1]benzofuran-2-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-3-methylbenzo[g][1]benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 7899905 |
| Molecular Formula | C20H13Cl2NO2 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.03 |
| IUPAC Name | N-(2,5-dichlorophenyl)-3-methylbenzo[g][1]benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)Nc2cc(Cl)ccc2Cl)oc2c1ccc1ccccc12 |
| InChI | InChI=1S/C20H13Cl2NO2/c1-11-14-8-6-12-4-2-3-5-15(12)19(14)25-18(11)20(24)23-17-10-13(21)7-9-16(17)22/h2-10H,1H3,(H,23,24) |
| InChIKey | RZWLVHBUYHJDPZ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |