C18H12ClF2N3O3 — CID 7735188
[2-(2,4-difluoroanilino)-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate (PubChem CID 7735188) has the molecular formula C18H12ClF2N3O3 and a molecular weight of 391.76 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7735188 |
| Molecular Formula | C18H12ClF2N3O3 |
| Molecular Weight | 391.76 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] (E)-3-(2-chloroimidazo[1,2-a]pyridin-3-yl)prop-2-enoate |
| SMILES | O=C(COC(=O)/C=C/c1c(Cl)nc2ccccn12)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C18H12ClF2N3O3/c19-18-14(24-8-2-1-3-15(24)23-18)6-7-17(26)27-10-16(25)22-13-5-4-11(20)9-12(13)21/h1-9H,10H2,(H,22,25)/b7-6+ |
| InChIKey | BVPAHKPLKKAGIG-VOTSOKGWSA-N |
| XLogP | 3.46 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.76 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|