C8H13ClN2 — CID 7736
4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride (PubChem CID 7736) has the molecular formula C8H13ClN2 and a molecular weight of 172.66 g/mol. Its IUPAC name is 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride.
| Compound Name | 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride |
|---|---|
| PubChem CID | 7736 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride |
| SMILES | CN(C)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C8H12N2.ClH/c1-10(2)8-5-3-7(9)4-6-8;/h3-6H,9H2,1-2H3;1H |
| InChIKey | KTWNIUBGGFBRKH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|