About 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride
4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride (PubChem CID 7736) has the molecular formula C8H13ClN2
and a molecular weight of 172.66 g/mol. Its IUPAC name is 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride.
Molecular Properties
| Compound Name | 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride |
| PubChem CID | 7736 |
| Molecular Formula | C8H13ClN2 |
| Molecular Weight | 172.66 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride |
| SMILES | CN(C)c1ccc(N)cc1.Cl |
| InChI | InChI=1S/C8H12N2.ClH/c1-10(2)8-5-3-7(9)4-6-8;/h3-6H,9H2,1-2H3;1H |
| InChIKey | KTWNIUBGGFBRKH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride?
The IUPAC name of 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride (CID 7736) is 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride.
What is the SMILES notation for 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride?
The canonical SMILES for 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride is CN(C)c1ccc(N)cc1.Cl.
What is the InChIKey of 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride?
The InChIKey is KTWNIUBGGFBRKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2.ClH/c1-10(2)8-5-3-7(9)4-6-8;/h3-6H,9H2,1-2H3;1H.
What are the key properties of 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride?
4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride has a molecular weight of 172.66 g/mol, XLogP of 1.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N,4-N-dimethylbenzene-1,4-diamine;hydrochloride is sourced from PubChem (CID 7736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).