C21H23FN2O3 — CID 77379431
benzyl 6-[(4-fluorophenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate (PubChem CID 77379431) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is benzyl 6-[(4-fluorophenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate.
| Compound Name | benzyl 6-[(4-fluorophenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 77379431 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | benzyl 6-[(4-fluorophenyl)methoxy]-3,3a,4,5,6,6a-hexahydro-2H-pyrrolo[3,2-b]pyrrole-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC2NCC(OCc3ccc(F)cc3)C21 |
| InChI | InChI=1S/C21H23FN2O3/c22-17-8-6-16(7-9-17)13-26-19-12-23-18-10-11-24(20(18)19)21(25)27-14-15-4-2-1-3-5-15/h1-9,18-20,23H,10-14H2 |
| InChIKey | XOXFGRCYAJKPQI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |