C19H24ClN3O2S — CID 7738120
7-chloro-2-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-propylquinazolin-4-one (PubChem CID 7738120) has the molecular formula C19H24ClN3O2S and a molecular weight of 393.94 g/mol. Its IUPAC name is 7-chloro-2-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-propylquinazolin-4-one.
| Compound Name | 7-chloro-2-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-propylquinazolin-4-one |
|---|---|
| PubChem CID | 7738120 |
| Molecular Formula | C19H24ClN3O2S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 7-chloro-2-[2-[(2R)-2-methylpiperidin-1-yl]-2-oxoethyl]sulfanyl-3-propylquinazolin-4-one |
| SMILES | CCCn1c(SCC(=O)N2CCCC[C@H]2C)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H24ClN3O2S/c1-3-9-23-18(25)15-8-7-14(20)11-16(15)21-19(23)26-12-17(24)22-10-5-4-6-13(22)2/h7-8,11,13H,3-6,9-10,12H2,1-2H3/t13-/m1/s1 |
| InChIKey | FPXVNLZYZGFLLX-CYBMUJFWSA-N |
| XLogP | 3.95 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |