C31H30ClN5O4 — CID 77391938
(4-methylphenyl) 6-chloro-1-[4-[3-hydroxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 77391938) has the molecular formula C31H30ClN5O4 and a molecular weight of 572.07 g/mol. Its IUPAC name is (4-methylphenyl) 6-chloro-1-[4-[3-hydroxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-methylphenyl) 6-chloro-1-[4-[3-hydroxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 77391938 |
| Molecular Formula | C31H30ClN5O4 |
| Molecular Weight | 572.07 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | (4-methylphenyl) 6-chloro-1-[4-[3-hydroxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2c2ccc(OCCC(O)Cn3cncn3)cc2)cc1 |
| InChI | InChI=1S/C31H30ClN5O4/c1-20-2-7-25(8-3-20)41-31(39)37-14-12-26-27-16-22(32)6-11-28(27)35-29(26)30(37)21-4-9-24(10-5-21)40-15-13-23(38)17-36-19-33-18-34-36/h2-11,16,18-19,23,30,35,38H,12-15,17H2,1H3 |
| InChIKey | QCCJWBYCCIXRCC-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.07 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|