C21H34O5 — CID 77398051
17-(1,2-dihydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-triol (PubChem CID 77398051) has the molecular formula C21H34O5 and a molecular weight of 366.50 g/mol. Its IUPAC name is 17-(1,2-dihydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-triol.
| Compound Name | 17-(1,2-dihydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-triol |
|---|---|
| PubChem CID | 77398051 |
| Molecular Formula | C21H34O5 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | 17-(1,2-dihydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,7,17-triol |
| SMILES | CC12CCC(O)CC1CC(O)C1C2=CCC2(C)C1CCC2(O)C(O)CO |
| InChI | InChI=1S/C21H34O5/c1-19-6-3-13(23)9-12(19)10-16(24)18-14(19)4-7-20(2)15(18)5-8-21(20,26)17(25)11-22/h4,12-13,15-18,22-26H,3,5-11H2,1-2H3 |
| InChIKey | OJRAIYYEUWULLJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|