C24H28N2O4 — CID 7739831
[(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 1-(2-methylbenzoyl)piperidine-4-carboxylate (PubChem CID 7739831) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 1-(2-methylbenzoyl)piperidine-4-carboxylate.
| Compound Name | [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 1-(2-methylbenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7739831 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 1-(2-methylbenzoyl)piperidine-4-carboxylate |
| SMILES | Cc1ccc(NC(=O)[C@@H](C)OC(=O)C2CCN(C(=O)c3ccccc3C)CC2)cc1 |
| InChI | InChI=1S/C24H28N2O4/c1-16-8-10-20(11-9-16)25-22(27)18(3)30-24(29)19-12-14-26(15-13-19)23(28)21-7-5-4-6-17(21)2/h4-11,18-19H,12-15H2,1-3H3,(H,25,27)/t18-/m1/s1 |
| InChIKey | GBWIEXHSESIVLO-GOSISDBHSA-N |
| XLogP | 3.73 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |