C13H15N3O6S — CID 7740423
[2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-(methanesulfonamido)benzoate (PubChem CID 7740423) has the molecular formula C13H15N3O6S and a molecular weight of 341.35 g/mol. Its IUPAC name is [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-(methanesulfonamido)benzoate.
| Compound Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-(methanesulfonamido)benzoate |
|---|---|
| PubChem CID | 7740423 |
| Molecular Formula | C13H15N3O6S |
| Molecular Weight | 341.35 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | [2-oxo-2-(2-oxoimidazolidin-1-yl)ethyl] 2-(methanesulfonamido)benzoate |
| SMILES | CS(=O)(=O)Nc1ccccc1C(=O)OCC(=O)N1CCNC1=O |
| InChI | InChI=1S/C13H15N3O6S/c1-23(20,21)15-10-5-3-2-4-9(10)12(18)22-8-11(17)16-7-6-14-13(16)19/h2-5,15H,6-8H2,1H3,(H,14,19) |
| InChIKey | ZLVRTVJCQRBJST-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.35 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |