C45H78O6 — CID 77429583
diethyl 2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 77429583) has the molecular formula C45H78O6 and a molecular weight of 715.11 g/mol. Its IUPAC name is diethyl 2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | diethyl 2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 77429583 |
| Molecular Formula | C45H78O6 |
| Molecular Weight | 715.11 g/mol |
| Exact Mass | 714.58 |
| IUPAC Name | diethyl 2,2-bis(octadeca-9,12-dienyl)-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CCCCCC=CCC=CCCCCCCCCC1(CCCCCCCCC=CCC=CCCCCC)OC(C(=O)OCC)C(C(=O)OCC)O1 |
| InChI | InChI=1S/C45H78O6/c1-5-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-39-45(50-41(43(46)48-7-3)42(51-45)44(47)49-8-4)40-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-6-2/h15-18,21-24,41-42H,5-14,19-20,25-40H2,1-4H3 |
| InChIKey | XBRYZOSLEOBUPN-UHFFFAOYSA-N |
| XLogP | 13.00 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.11 |
| LogP ≤ 5 | 13.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|