C21H31NO — CID 77431575
1-(3-imino-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethanone (PubChem CID 77431575) has the molecular formula C21H31NO and a molecular weight of 313.48 g/mol. Its IUPAC name is 1-(3-imino-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethanone.
| Compound Name | 1-(3-imino-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethanone |
|---|---|
| PubChem CID | 77431575 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.48 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | 1-(3-imino-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl)ethanone |
| SMILES | [H]/N=C1/C=C2CCC3C(CCC4(C)C(C(C)=O)CCC34)C2(C)CC1 |
| InChI | InChI=1S/C21H31NO/c1-13(23)17-6-7-18-16-5-4-14-12-15(22)8-10-20(14,2)19(16)9-11-21(17,18)3/h12,16-19,22H,4-11H2,1-3H3/b22-15+ |
| InChIKey | LMIBODNVKGFFNT-PXLXIMEGSA-N |
| XLogP | 5.17 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|