C26H40NO+ — CID 99572607
1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-piperidin-1-ium-1-ylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone (PubChem CID 99572607) has the molecular formula C26H40NO+ and a molecular weight of 382.61 g/mol. Its IUPAC name is 1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-piperidin-1-ium-1-ylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone.
| Compound Name | 1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-piperidin-1-ium-1-ylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
|---|---|
| PubChem CID | 99572607 |
| Molecular Formula | C26H40NO+ |
| Molecular Weight | 382.61 g/mol |
| Exact Mass | 382.31 |
| IUPAC Name | 1-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-piperidin-1-ium-1-ylidene-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]ethanone |
| SMILES | CC(=O)[C@H]1CC[C@H]2[C@@H]3CCC4=CC(=[N+]5CCCCC5)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C26H40NO/c1-18(28)22-9-10-23-21-8-7-19-17-20(27-15-5-4-6-16-27)11-13-25(19,2)24(21)12-14-26(22,23)3/h17,21-24H,4-16H2,1-3H3/q+1/t21-,22+,23-,24-,25-,26+/m0/s1 |
| InChIKey | LTBNRQAXXPRPMN-FBQZJRKBSA-N |
| XLogP | 5.79 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.61 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|