C26H36N4O3 — CID 77439339
benzyl 4-(3-aminopropoxy)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrrolidine-1-carboxylate (PubChem CID 77439339) has the molecular formula C26H36N4O3 and a molecular weight of 452.60 g/mol. Its IUPAC name is benzyl 4-(3-aminopropoxy)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 4-(3-aminopropoxy)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 77439339 |
| Molecular Formula | C26H36N4O3 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | benzyl 4-(3-aminopropoxy)-2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CN(CC1CC(OCCCN)CN1C(=O)OCc1ccccc1)C1CCCc2cccnc21 |
| InChI | InChI=1S/C26H36N4O3/c1-29(24-12-5-10-21-11-6-14-28-25(21)24)17-22-16-23(32-15-7-13-27)18-30(22)26(31)33-19-20-8-3-2-4-9-20/h2-4,6,8-9,11,14,22-24H,5,7,10,12-13,15-19,27H2,1H3 |
| InChIKey | RJOTZDLDLYFCOB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|