C41H49N5O6 — CID 155767247
8-O-benzyl 3-O-tert-butyl (1R,5S)-2-[[4-(1,3-dioxoisoindol-2-yl)butyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate (PubChem CID 155767247) has the molecular formula C41H49N5O6 and a molecular weight of 707.87 g/mol. Its IUPAC name is 8-O-benzyl 3-O-tert-butyl (1R,5S)-2-[[4-(1,3-dioxoisoindol-2-yl)butyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate.
| Compound Name | 8-O-benzyl 3-O-tert-butyl (1R,5S)-2-[[4-(1,3-dioxoisoindol-2-yl)butyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate |
|---|---|
| PubChem CID | 155767247 |
| Molecular Formula | C41H49N5O6 |
| Molecular Weight | 707.87 g/mol |
| Exact Mass | 707.37 |
| IUPAC Name | 8-O-benzyl 3-O-tert-butyl (1R,5S)-2-[[4-(1,3-dioxoisoindol-2-yl)butyl-[(8S)-5,6,7,8-tetrahydroquinolin-8-yl]amino]methyl]-3,8-diazabicyclo[3.2.1]octane-3,8-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC[C@H](C1CN(CCCCN1C(=O)c3ccccc3C1=O)[C@H]1CCCc3cccnc31)N2C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C41H49N5O6/c1-41(2,3)52-39(49)45-25-30-20-21-33(46(30)40(50)51-27-28-13-5-4-6-14-28)35(45)26-43(34-19-11-15-29-16-12-22-42-36(29)34)23-9-10-24-44-37(47)31-17-7-8-18-32(31)38(44)48/h4-8,12-14,16-18,22,30,33-35H,9-11,15,19-21,23-27H2,1-3H3/t30-,33+,34-,35?/m0/s1 |
| InChIKey | WWMYIFJYMTXDNZ-RQGZNCALSA-N |
| XLogP | 6.63 |
| TPSA | 112.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.87 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|