C28H26N6O2 — CID 77443545
N-(4-cyanophenyl)-4-[4-(4-methoxyphenyl)phthalazin-1-yl]-2-methylpiperazine-1-carboxamide (PubChem CID 77443545) has the molecular formula C28H26N6O2 and a molecular weight of 478.56 g/mol. Its IUPAC name is N-(4-cyanophenyl)-4-[4-(4-methoxyphenyl)phthalazin-1-yl]-2-methylpiperazine-1-carboxamide.
| Compound Name | N-(4-cyanophenyl)-4-[4-(4-methoxyphenyl)phthalazin-1-yl]-2-methylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 77443545 |
| Molecular Formula | C28H26N6O2 |
| Molecular Weight | 478.56 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | N-(4-cyanophenyl)-4-[4-(4-methoxyphenyl)phthalazin-1-yl]-2-methylpiperazine-1-carboxamide |
| SMILES | COc1ccc(-c2nnc(N3CCN(C(=O)Nc4ccc(C#N)cc4)C(C)C3)c3ccccc23)cc1 |
| InChI | InChI=1S/C28H26N6O2/c1-19-18-33(15-16-34(19)28(35)30-22-11-7-20(17-29)8-12-22)27-25-6-4-3-5-24(25)26(31-32-27)21-9-13-23(36-2)14-10-21/h3-14,19H,15-16,18H2,1-2H3,(H,30,35) |
| InChIKey | NAVJKMGZIBPWEB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 94.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |