C26H27F2N7O2S — CID 77446988
3-amino-5-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,6-difluorophenyl)methylamino]-6-methylpyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 77446988) has the molecular formula C26H27F2N7O2S and a molecular weight of 539.61 g/mol. Its IUPAC name is 3-amino-5-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,6-difluorophenyl)methylamino]-6-methylpyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | 3-amino-5-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,6-difluorophenyl)methylamino]-6-methylpyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 77446988 |
| Molecular Formula | C26H27F2N7O2S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | 3-amino-5-[[5-(4-cyclopropyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)-2-[(2,6-difluorophenyl)methylamino]-6-methylpyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | Cc1nc(NCc2c(F)cccc2F)nc(NC2CC(N)C(O)C2O)c1-c1nc2c(C3CC3)nccc2s1 |
| InChI | InChI=1S/C26H27F2N7O2S/c1-11-19(25-34-21-18(38-25)7-8-30-20(21)12-5-6-12)24(33-17-9-16(29)22(36)23(17)37)35-26(32-11)31-10-13-14(27)3-2-4-15(13)28/h2-4,7-8,12,16-17,22-23,36-37H,5-6,9-10,29H2,1H3,(H2,31,32,33,35) |
| InChIKey | UFZUEPPTOZNCGU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 142.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |