C30H29N3O4 — CID 77451421
N-(1,3-benzodioxol-5-yl)-2-[[2-(7-ethenyl-2-methyl-1H-indol-3-yl)acetyl]amino]-N-methyl-3-phenylpropanamide (PubChem CID 77451421) has the molecular formula C30H29N3O4 and a molecular weight of 495.58 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-2-[[2-(7-ethenyl-2-methyl-1H-indol-3-yl)acetyl]amino]-N-methyl-3-phenylpropanamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(7-ethenyl-2-methyl-1H-indol-3-yl)acetyl]amino]-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 77451421 |
| Molecular Formula | C30H29N3O4 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-2-[[2-(7-ethenyl-2-methyl-1H-indol-3-yl)acetyl]amino]-N-methyl-3-phenylpropanamide |
| SMILES | C=Cc1cccc2c(CC(=O)NC(Cc3ccccc3)C(=O)N(C)c3ccc4c(c3)OCO4)c(C)[nH]c12 |
| InChI | InChI=1S/C30H29N3O4/c1-4-21-11-8-12-23-24(19(2)31-29(21)23)17-28(34)32-25(15-20-9-6-5-7-10-20)30(35)33(3)22-13-14-26-27(16-22)37-18-36-26/h4-14,16,25,31H,1,15,17-18H2,2-3H3,(H,32,34) |
| InChIKey | KYSIRDICBFGCOF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 83.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|