C18H25BrN2O3 — CID 77454703
9-[amino(hydroxy)methyl]-3-[1-(4-bromophenyl)ethyl]-1-oxa-3-azaspiro[5.5]undecan-2-one (PubChem CID 77454703) has the molecular formula C18H25BrN2O3 and a molecular weight of 397.31 g/mol. Its IUPAC name is 9-[amino(hydroxy)methyl]-3-[1-(4-bromophenyl)ethyl]-1-oxa-3-azaspiro[5.5]undecan-2-one.
| Compound Name | 9-[amino(hydroxy)methyl]-3-[1-(4-bromophenyl)ethyl]-1-oxa-3-azaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 77454703 |
| Molecular Formula | C18H25BrN2O3 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 9-[amino(hydroxy)methyl]-3-[1-(4-bromophenyl)ethyl]-1-oxa-3-azaspiro[5.5]undecan-2-one |
| SMILES | CC(c1ccc(Br)cc1)N1CCC2(CCC(C(N)O)CC2)OC1=O |
| InChI | InChI=1S/C18H25BrN2O3/c1-12(13-2-4-15(19)5-3-13)21-11-10-18(24-17(21)23)8-6-14(7-9-18)16(20)22/h2-5,12,14,16,22H,6-11,20H2,1H3 |
| InChIKey | YAJPBBWILNGUKG-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|