C36H50N2O8 — CID 160709287
9-hydroxy-3-[(1S)-1-(3-methoxyphenyl)ethyl]-1-oxa-3-azaspiro[5.5]undecan-2-one (PubChem CID 160709287) has the molecular formula C36H50N2O8 and a molecular weight of 638.80 g/mol. Its IUPAC name is 9-hydroxy-3-[(1S)-1-(3-methoxyphenyl)ethyl]-1-oxa-3-azaspiro[5.5]undecan-2-one.
| Compound Name | 9-hydroxy-3-[(1S)-1-(3-methoxyphenyl)ethyl]-1-oxa-3-azaspiro[5.5]undecan-2-one |
|---|---|
| PubChem CID | 160709287 |
| Molecular Formula | C36H50N2O8 |
| Molecular Weight | 638.80 g/mol |
| Exact Mass | 638.36 |
| IUPAC Name | 9-hydroxy-3-[(1S)-1-(3-methoxyphenyl)ethyl]-1-oxa-3-azaspiro[5.5]undecan-2-one |
| SMILES | COc1cccc([C@H](C)N2CCC3(CCC(O)CC3)OC2=O)c1.COc1cccc([C@H](C)N2CCC3(CCC(O)CC3)OC2=O)c1 |
| InChI | InChI=1S/2C18H25NO4/c2*1-13(14-4-3-5-16(12-14)22-2)19-11-10-18(23-17(19)21)8-6-15(20)7-9-18/h2*3-5,12-13,15,20H,6-11H2,1-2H3/t2*13-,15?,18?/m00/s1 |
| InChIKey | RRQGTRGZZOGUHS-IWSURQDPSA-N |
| XLogP | 6.54 |
| TPSA | 118.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.80 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |