C22H30N2O3 — CID 24952608
1-(5-hydroxy-2-adamantyl)-3-[(1S)-1-(3-methoxyphenyl)ethyl]imidazolidin-2-one (PubChem CID 24952608) has the molecular formula C22H30N2O3 and a molecular weight of 370.49 g/mol. Its IUPAC name is 1-(5-hydroxy-2-adamantyl)-3-[(1S)-1-(3-methoxyphenyl)ethyl]imidazolidin-2-one.
| Compound Name | 1-(5-hydroxy-2-adamantyl)-3-[(1S)-1-(3-methoxyphenyl)ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 24952608 |
| Molecular Formula | C22H30N2O3 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 1-(5-hydroxy-2-adamantyl)-3-[(1S)-1-(3-methoxyphenyl)ethyl]imidazolidin-2-one |
| SMILES | COc1cccc([C@H](C)N2CCN(C3C4CC5CC3CC(O)(C5)C4)C2=O)c1 |
| InChI | InChI=1S/C22H30N2O3/c1-14(16-4-3-5-19(10-16)27-2)23-6-7-24(21(23)25)20-17-8-15-9-18(20)13-22(26,11-15)12-17/h3-5,10,14-15,17-18,20,26H,6-9,11-13H2,1-2H3/t14-,15?,17?,18?,20?,22?/m0/s1 |
| InChIKey | RJIBZTRLLVFALE-QIDZMIKESA-N |
| XLogP | 3.43 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |