C21H28N2O3 — CID 57495574
1-(5-hydroxy-2-adamantyl)-4-(2-methoxyphenyl)-4-methylimidazolidin-2-one (PubChem CID 57495574) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 1-(5-hydroxy-2-adamantyl)-4-(2-methoxyphenyl)-4-methylimidazolidin-2-one.
| Compound Name | 1-(5-hydroxy-2-adamantyl)-4-(2-methoxyphenyl)-4-methylimidazolidin-2-one |
|---|---|
| PubChem CID | 57495574 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 1-(5-hydroxy-2-adamantyl)-4-(2-methoxyphenyl)-4-methylimidazolidin-2-one |
| SMILES | COc1ccccc1C1(C)CN(C2C3CC4CC2CC(O)(C4)C3)C(=O)N1 |
| InChI | InChI=1S/C21H28N2O3/c1-20(16-5-3-4-6-17(16)26-2)12-23(19(24)22-20)18-14-7-13-8-15(18)11-21(25,9-13)10-14/h3-6,13-15,18,25H,7-12H2,1-2H3,(H,22,24) |
| InChIKey | IIVPTPUUHJTEDB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |