C21H27ClN2O2 — CID 59361503
2-(5-chloro-2-adamantyl)-1-(2-methoxyphenyl)-4,4-dimethyldiazetidin-3-one (PubChem CID 59361503) has the molecular formula C21H27ClN2O2 and a molecular weight of 374.91 g/mol. Its IUPAC name is 2-(5-chloro-2-adamantyl)-1-(2-methoxyphenyl)-4,4-dimethyldiazetidin-3-one.
| Compound Name | 2-(5-chloro-2-adamantyl)-1-(2-methoxyphenyl)-4,4-dimethyldiazetidin-3-one |
|---|---|
| PubChem CID | 59361503 |
| Molecular Formula | C21H27ClN2O2 |
| Molecular Weight | 374.91 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-(5-chloro-2-adamantyl)-1-(2-methoxyphenyl)-4,4-dimethyldiazetidin-3-one |
| SMILES | COc1ccccc1N1N(C2C3CC4CC2CC(Cl)(C4)C3)C(=O)C1(C)C |
| InChI | InChI=1S/C21H27ClN2O2/c1-20(2)19(25)23(24(20)16-6-4-5-7-17(16)26-3)18-14-8-13-9-15(18)12-21(22,10-13)11-14/h4-7,13-15,18H,8-12H2,1-3H3 |
| InChIKey | TVULIUCNVJYFKV-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.91 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|