C21H24Cl3NO — CID 46184114
1-[(1S,3S)-5-chloro-2-adamantyl]-4-(2,3-dichlorophenyl)-3,3-dimethylazetidin-2-one (PubChem CID 46184114) has the molecular formula C21H24Cl3NO and a molecular weight of 412.79 g/mol. Its IUPAC name is 1-[(1S,3S)-5-chloro-2-adamantyl]-4-(2,3-dichlorophenyl)-3,3-dimethylazetidin-2-one.
| Compound Name | 1-[(1S,3S)-5-chloro-2-adamantyl]-4-(2,3-dichlorophenyl)-3,3-dimethylazetidin-2-one |
|---|---|
| PubChem CID | 46184114 |
| Molecular Formula | C21H24Cl3NO |
| Molecular Weight | 412.79 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 1-[(1S,3S)-5-chloro-2-adamantyl]-4-(2,3-dichlorophenyl)-3,3-dimethylazetidin-2-one |
| SMILES | CC1(C)C(=O)N(C2[C@H]3CC4C[C@H]2CC(Cl)(C4)C3)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C21H24Cl3NO/c1-20(2)18(14-4-3-5-15(22)16(14)23)25(19(20)26)17-12-6-11-7-13(17)10-21(24,8-11)9-12/h3-5,11-13,17-18H,6-10H2,1-2H3/t11?,12-,13-,17?,18?,21?/m0/s1 |
| InChIKey | CGLBHVXAECFODN-XMMUZSHKSA-N |
| XLogP | 6.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.79 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|