C25H29NO2 — CID 46185877
1-[(1S,3S)-5-hydroxy-2-adamantyl]-3,3-dimethyl-4-naphthalen-1-ylazetidin-2-one (PubChem CID 46185877) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is 1-[(1S,3S)-5-hydroxy-2-adamantyl]-3,3-dimethyl-4-naphthalen-1-ylazetidin-2-one.
| Compound Name | 1-[(1S,3S)-5-hydroxy-2-adamantyl]-3,3-dimethyl-4-naphthalen-1-ylazetidin-2-one |
|---|---|
| PubChem CID | 46185877 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 1-[(1S,3S)-5-hydroxy-2-adamantyl]-3,3-dimethyl-4-naphthalen-1-ylazetidin-2-one |
| SMILES | CC1(C)C(=O)N(C2[C@H]3CC4C[C@H]2CC(O)(C4)C3)C1c1cccc2ccccc12 |
| InChI | InChI=1S/C25H29NO2/c1-24(2)22(20-9-5-7-16-6-3-4-8-19(16)20)26(23(24)27)21-17-10-15-11-18(21)14-25(28,12-15)13-17/h3-9,15,17-18,21-22,28H,10-14H2,1-2H3/t15?,17-,18-,21?,22?,25?/m0/s1 |
| InChIKey | KJCSODFAFHLEGI-LEYDFZOOSA-N |
| XLogP | 4.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |