C26H32N2O4 — CID 56941033
3-ethyl-N-(5-hydroxy-2-adamantyl)-5-(3-methoxybenzoyl)-1-methylpyrrole-2-carboxamide (PubChem CID 56941033) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is 3-ethyl-N-(5-hydroxy-2-adamantyl)-5-(3-methoxybenzoyl)-1-methylpyrrole-2-carboxamide.
| Compound Name | 3-ethyl-N-(5-hydroxy-2-adamantyl)-5-(3-methoxybenzoyl)-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 56941033 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | 3-ethyl-N-(5-hydroxy-2-adamantyl)-5-(3-methoxybenzoyl)-1-methylpyrrole-2-carboxamide |
| SMILES | CCc1cc(C(=O)c2cccc(OC)c2)n(C)c1C(=O)NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C26H32N2O4/c1-4-16-11-21(24(29)17-6-5-7-20(10-17)32-3)28(2)23(16)25(30)27-22-18-8-15-9-19(22)14-26(31,12-15)13-18/h5-7,10-11,15,18-19,22,31H,4,8-9,12-14H2,1-3H3,(H,27,30) |
| InChIKey | RPSIGSJDLWQMRX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |