C24H34BNO5 — CID 66635743
4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N-(5-hydroxy-2-adamantyl)-2-(methoxymethyl)benzamide (PubChem CID 66635743) has the molecular formula C24H34BNO5 and a molecular weight of 427.35 g/mol. Its IUPAC name is 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N-(5-hydroxy-2-adamantyl)-2-(methoxymethyl)benzamide.
| Compound Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N-(5-hydroxy-2-adamantyl)-2-(methoxymethyl)benzamide |
|---|---|
| PubChem CID | 66635743 |
| Molecular Formula | C24H34BNO5 |
| Molecular Weight | 427.35 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 4-(5,5-dimethyl-1,3,2-dioxaborinan-2-yl)-N-(5-hydroxy-2-adamantyl)-2-(methoxymethyl)benzamide |
| SMILES | COCc1cc(B2OCC(C)(C)CO2)ccc1C(=O)NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C24H34BNO5/c1-23(2)13-30-25(31-14-23)19-4-5-20(18(8-19)12-29-3)22(27)26-21-16-6-15-7-17(21)11-24(28,9-15)10-16/h4-5,8,15-17,21,28H,6-7,9-14H2,1-3H3,(H,26,27) |
| InChIKey | RRWBIJKLXJFJRQ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|