C25H30N2O4 — CID 56942337
N-(5-hydroxy-2-adamantyl)-2-(methoxymethyl)-4-(1-methylpyrrole-2-carbonyl)benzamide (PubChem CID 56942337) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-2-(methoxymethyl)-4-(1-methylpyrrole-2-carbonyl)benzamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-2-(methoxymethyl)-4-(1-methylpyrrole-2-carbonyl)benzamide |
|---|---|
| PubChem CID | 56942337 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-2-(methoxymethyl)-4-(1-methylpyrrole-2-carbonyl)benzamide |
| SMILES | COCc1cc(C(=O)c2cccn2C)ccc1C(=O)NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C25H30N2O4/c1-27-7-3-4-21(27)23(28)16-5-6-20(19(10-16)14-31-2)24(29)26-22-17-8-15-9-18(22)13-25(30,11-15)12-17/h3-7,10,15,17-18,22,30H,8-9,11-14H2,1-2H3,(H,26,29) |
| InChIKey | UFDAFUBWVBLEEO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |