C18H26ClN3O3 — CID 142697503
5-(1-chloro-3-methoxypropyl)-N-(5-hydroxy-2-adamantyl)-1H-pyrazole-4-carboxamide (PubChem CID 142697503) has the molecular formula C18H26ClN3O3 and a molecular weight of 367.88 g/mol. Its IUPAC name is 5-(1-chloro-3-methoxypropyl)-N-(5-hydroxy-2-adamantyl)-1H-pyrazole-4-carboxamide.
| Compound Name | 5-(1-chloro-3-methoxypropyl)-N-(5-hydroxy-2-adamantyl)-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142697503 |
| Molecular Formula | C18H26ClN3O3 |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 5-(1-chloro-3-methoxypropyl)-N-(5-hydroxy-2-adamantyl)-1H-pyrazole-4-carboxamide |
| SMILES | COCCC(Cl)c1[nH]ncc1C(=O)NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C18H26ClN3O3/c1-25-3-2-14(19)16-13(9-20-22-16)17(23)21-15-11-4-10-5-12(15)8-18(24,6-10)7-11/h9-12,14-15,24H,2-8H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | QZWOTVSNHQCJKJ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|