C26H27F2NO3 — CID 56942967
4-(3,5-difluorobenzoyl)-2-ethyl-N-(5-hydroxy-2-adamantyl)benzamide (PubChem CID 56942967) has the molecular formula C26H27F2NO3 and a molecular weight of 439.50 g/mol. Its IUPAC name is 4-(3,5-difluorobenzoyl)-2-ethyl-N-(5-hydroxy-2-adamantyl)benzamide.
| Compound Name | 4-(3,5-difluorobenzoyl)-2-ethyl-N-(5-hydroxy-2-adamantyl)benzamide |
|---|---|
| PubChem CID | 56942967 |
| Molecular Formula | C26H27F2NO3 |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 4-(3,5-difluorobenzoyl)-2-ethyl-N-(5-hydroxy-2-adamantyl)benzamide |
| SMILES | CCc1cc(C(=O)c2cc(F)cc(F)c2)ccc1C(=O)NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C26H27F2NO3/c1-2-15-7-16(24(30)17-8-20(27)10-21(28)9-17)3-4-22(15)25(31)29-23-18-5-14-6-19(23)13-26(32,11-14)12-18/h3-4,7-10,14,18-19,23,32H,2,5-6,11-13H2,1H3,(H,29,31) |
| InChIKey | ZPDSFJBXZUSGNI-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |