C24H23F2NO3 — CID 66635409
2-fluoro-4-(2-fluorobenzoyl)-N-(5-hydroxy-2-adamantyl)benzamide (PubChem CID 66635409) has the molecular formula C24H23F2NO3 and a molecular weight of 411.45 g/mol. Its IUPAC name is 2-fluoro-4-(2-fluorobenzoyl)-N-(5-hydroxy-2-adamantyl)benzamide.
| Compound Name | 2-fluoro-4-(2-fluorobenzoyl)-N-(5-hydroxy-2-adamantyl)benzamide |
|---|---|
| PubChem CID | 66635409 |
| Molecular Formula | C24H23F2NO3 |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 2-fluoro-4-(2-fluorobenzoyl)-N-(5-hydroxy-2-adamantyl)benzamide |
| SMILES | O=C(NC1C2CC3CC1CC(O)(C3)C2)c1ccc(C(=O)c2ccccc2F)cc1F |
| InChI | InChI=1S/C24H23F2NO3/c25-19-4-2-1-3-17(19)22(28)14-5-6-18(20(26)9-14)23(29)27-21-15-7-13-8-16(21)12-24(30,10-13)11-15/h1-6,9,13,15-16,21,30H,7-8,10-12H2,(H,27,29) |
| InChIKey | VYKQTYMHCRZQLU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |