C26H37N3O4S — CID 69050993
4-[[5-[(5-hydroxy-2-adamantyl)carbamoyl]-6-propyl-3-sulfanyl-2-pyridinyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 69050993) has the molecular formula C26H37N3O4S and a molecular weight of 487.67 g/mol. Its IUPAC name is 4-[[5-[(5-hydroxy-2-adamantyl)carbamoyl]-6-propyl-3-sulfanyl-2-pyridinyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[5-[(5-hydroxy-2-adamantyl)carbamoyl]-6-propyl-3-sulfanyl-2-pyridinyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 69050993 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 4-[[5-[(5-hydroxy-2-adamantyl)carbamoyl]-6-propyl-3-sulfanyl-2-pyridinyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CCCc1nc(NC2CCC(C(=O)O)CC2)c(S)cc1C(=O)NC1C2CC3CC1CC(O)(C3)C2 |
| InChI | InChI=1S/C26H37N3O4S/c1-2-3-20-19(10-21(34)23(28-20)27-18-6-4-15(5-7-18)25(31)32)24(30)29-22-16-8-14-9-17(22)13-26(33,11-14)12-16/h10,14-18,22,33-34H,2-9,11-13H2,1H3,(H,27,28)(H,29,30)(H,31,32) |
| InChIKey | FHKOYRLQFGMLAB-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|