C26H38N2O4 — CID 10072060
N-(5-hydroxy-2-adamantyl)-2-methyl-2-[3-(2-morpholin-4-ylethoxy)phenyl]propanamide (PubChem CID 10072060) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-2-methyl-2-[3-(2-morpholin-4-ylethoxy)phenyl]propanamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-2-methyl-2-[3-(2-morpholin-4-ylethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 10072060 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-2-methyl-2-[3-(2-morpholin-4-ylethoxy)phenyl]propanamide |
| SMILES | CC(C)(C(=O)NC1C2CC3CC1CC(O)(C3)C2)c1cccc(OCCN2CCOCC2)c1 |
| InChI | InChI=1S/C26H38N2O4/c1-25(2,21-4-3-5-22(14-21)32-11-8-28-6-9-31-10-7-28)24(29)27-23-19-12-18-13-20(23)17-26(30,15-18)16-19/h3-5,14,18-20,23,30H,6-13,15-17H2,1-2H3,(H,27,29) |
| InChIKey | YYZCNPSWYABHGL-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |