C15H14F6N2O4 — CID 7745671
ethyl (2R)-2-acetyl-4,4,4-trifluoro-3-(pyridine-3-carbonylamino)-3-(trifluoromethyl)butanoate (PubChem CID 7745671) has the molecular formula C15H14F6N2O4 and a molecular weight of 400.28 g/mol. Its IUPAC name is ethyl (2R)-2-acetyl-4,4,4-trifluoro-3-(pyridine-3-carbonylamino)-3-(trifluoromethyl)butanoate.
| Compound Name | ethyl (2R)-2-acetyl-4,4,4-trifluoro-3-(pyridine-3-carbonylamino)-3-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 7745671 |
| Molecular Formula | C15H14F6N2O4 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 400.09 |
| IUPAC Name | ethyl (2R)-2-acetyl-4,4,4-trifluoro-3-(pyridine-3-carbonylamino)-3-(trifluoromethyl)butanoate |
| SMILES | CCOC(=O)[C@@H](C(C)=O)C(NC(=O)c1cccnc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H14F6N2O4/c1-3-27-12(26)10(8(2)24)13(14(16,17)18,15(19,20)21)23-11(25)9-5-4-6-22-7-9/h4-7,10H,3H2,1-2H3,(H,23,25)/t10-/m1/s1 |
| InChIKey | MVRKKFNBRPIEIB-SNVBAGLBSA-N |
| XLogP | 2.44 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|