C26H28ClN5O4 — CID 77457729
ethyl 6-chloro-1-[4-[3-hydroxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 77457729) has the molecular formula C26H28ClN5O4 and a molecular weight of 509.99 g/mol. Its IUPAC name is ethyl 6-chloro-1-[4-[3-hydroxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | ethyl 6-chloro-1-[4-[3-hydroxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 77457729 |
| Molecular Formula | C26H28ClN5O4 |
| Molecular Weight | 509.99 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | ethyl 6-chloro-1-[4-[3-hydroxy-4-(1,2,4-triazol-1-yl)butoxy]phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | CCOC(=O)N1CCc2c([nH]c3ccc(Cl)cc23)C1c1ccc(OCCC(O)Cn2cncn2)cc1 |
| InChI | InChI=1S/C26H28ClN5O4/c1-2-35-26(34)32-11-9-21-22-13-18(27)5-8-23(22)30-24(21)25(32)17-3-6-20(7-4-17)36-12-10-19(33)14-31-16-28-15-29-31/h3-8,13,15-16,19,25,30,33H,2,9-12,14H2,1H3 |
| InChIKey | ZNIQAVOWNHHUQL-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.99 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|