C15H21N2O2+ — CID 7745942
tert-butyl-[(3S)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]azanium (PubChem CID 7745942) has the molecular formula C15H21N2O2+ and a molecular weight of 261.34 g/mol. Its IUPAC name is tert-butyl-[(3S)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]azanium.
| Compound Name | tert-butyl-[(3S)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
|---|---|
| PubChem CID | 7745942 |
| Molecular Formula | C15H21N2O2+ |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.16 |
| IUPAC Name | tert-butyl-[(3S)-1-(3-methylphenyl)-2,5-dioxopyrrolidin-3-yl]azanium |
| SMILES | Cc1cccc(N2C(=O)C[C@H]([NH2+]C(C)(C)C)C2=O)c1 |
| InChI | InChI=1S/C15H20N2O2/c1-10-6-5-7-11(8-10)17-13(18)9-12(14(17)19)16-15(2,3)4/h5-8,12,16H,9H2,1-4H3/p+1/t12-/m0/s1 |
| InChIKey | BFGZERSUPSRMDG-LBPRGKRZSA-O |
| XLogP | 0.99 |
| TPSA | 53.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|