C29H17F2NO — CID 77461528
4,5-bis(4-fluorophenyl)-1-phenylbenzo[cd]indol-2-one (PubChem CID 77461528) has the molecular formula C29H17F2NO and a molecular weight of 433.46 g/mol. Its IUPAC name is 4,5-bis(4-fluorophenyl)-1-phenylbenzo[cd]indol-2-one.
| Compound Name | 4,5-bis(4-fluorophenyl)-1-phenylbenzo[cd]indol-2-one |
|---|---|
| PubChem CID | 77461528 |
| Molecular Formula | C29H17F2NO |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.13 |
| IUPAC Name | 4,5-bis(4-fluorophenyl)-1-phenylbenzo[cd]indol-2-one |
| SMILES | O=C1c2cc(-c3ccc(F)cc3)c(-c3ccc(F)cc3)c3cccc(c23)N1c1ccccc1 |
| InChI | InChI=1S/C29H17F2NO/c30-20-13-9-18(10-14-20)24-17-25-28-23(27(24)19-11-15-21(31)16-12-19)7-4-8-26(28)32(29(25)33)22-5-2-1-3-6-22/h1-17H |
| InChIKey | DICMSYHEUBHJJZ-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |