C13H17N5O2S — CID 7746436
2-[(4-amino-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide (PubChem CID 7746436) has the molecular formula C13H17N5O2S and a molecular weight of 307.38 g/mol. Its IUPAC name is 2-[(4-amino-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide.
| Compound Name | 2-[(4-amino-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 7746436 |
| Molecular Formula | C13H17N5O2S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | 2-[(4-amino-5-propan-2-yl-1,2,4-triazol-3-yl)sulfanyl]-N-(2-hydroxyphenyl)acetamide |
| SMILES | CC(C)c1nnc(SCC(=O)Nc2ccccc2O)n1N |
| InChI | InChI=1S/C13H17N5O2S/c1-8(2)12-16-17-13(18(12)14)21-7-11(20)15-9-5-3-4-6-10(9)19/h3-6,8,19H,7,14H2,1-2H3,(H,15,20) |
| InChIKey | NJWQIBQQKOFRSI-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|