C22H26N2O2 — CID 77464610
1-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenylcyclopropane-1-carboxylic acid (PubChem CID 77464610) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is 1-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenylcyclopropane-1-carboxylic acid.
| Compound Name | 1-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 77464610 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 1-methyl-2-[4-(4-methylpiperazin-1-yl)phenyl]-3-phenylcyclopropane-1-carboxylic acid |
| SMILES | CN1CCN(c2ccc(C3C(c4ccccc4)C3(C)C(=O)O)cc2)CC1 |
| InChI | InChI=1S/C22H26N2O2/c1-22(21(25)26)19(16-6-4-3-5-7-16)20(22)17-8-10-18(11-9-17)24-14-12-23(2)13-15-24/h3-11,19-20H,12-15H2,1-2H3,(H,25,26) |
| InChIKey | ZKIHPQCVTMGZHW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|