C32H34F4O — CID 77470278
1-[2-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethenyl]-2,3-difluoro-4-(4-pentylphenyl)benzene (PubChem CID 77470278) has the molecular formula C32H34F4O and a molecular weight of 510.62 g/mol. Its IUPAC name is 1-[2-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethenyl]-2,3-difluoro-4-(4-pentylphenyl)benzene.
| Compound Name | 1-[2-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethenyl]-2,3-difluoro-4-(4-pentylphenyl)benzene |
|---|---|
| PubChem CID | 77470278 |
| Molecular Formula | C32H34F4O |
| Molecular Weight | 510.62 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 1-[2-[4-(2,3-difluoro-4-methoxyphenyl)cyclohexyl]ethenyl]-2,3-difluoro-4-(4-pentylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2ccc(C=CC3CCC(c4ccc(OC)c(F)c4F)CC3)c(F)c2F)cc1 |
| InChI | InChI=1S/C32H34F4O/c1-3-4-5-6-21-7-12-23(13-8-21)26-18-17-25(29(33)30(26)34)16-11-22-9-14-24(15-10-22)27-19-20-28(37-2)32(36)31(27)35/h7-8,11-13,16-20,22,24H,3-6,9-10,14-15H2,1-2H3 |
| InChIKey | DOIXNRITAKZKMQ-UHFFFAOYSA-N |
| XLogP | 9.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.62 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|