C19H21N3O4 — CID 77473548
2-[[3-(2-methylphenyl)-2-(pyridine-4-carbonylamino)propanoyl]amino]propanoic acid (PubChem CID 77473548) has the molecular formula C19H21N3O4 and a molecular weight of 355.39 g/mol. Its IUPAC name is 2-[[3-(2-methylphenyl)-2-(pyridine-4-carbonylamino)propanoyl]amino]propanoic acid.
| Compound Name | 2-[[3-(2-methylphenyl)-2-(pyridine-4-carbonylamino)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 77473548 |
| Molecular Formula | C19H21N3O4 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 2-[[3-(2-methylphenyl)-2-(pyridine-4-carbonylamino)propanoyl]amino]propanoic acid |
| SMILES | Cc1ccccc1CC(NC(=O)c1ccncc1)C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C19H21N3O4/c1-12-5-3-4-6-15(12)11-16(18(24)21-13(2)19(25)26)22-17(23)14-7-9-20-10-8-14/h3-10,13,16H,11H2,1-2H3,(H,21,24)(H,22,23)(H,25,26) |
| InChIKey | SLSWQRPFOHOPCZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |