C25H38N2O7 — CID 77474708
tert-butyl 2-[cyclopropyl-[1-[4-hydroxy-3-(3-methoxypropoxy)phenyl]ethyl]carbamoyl]morpholine-4-carboxylate (PubChem CID 77474708) has the molecular formula C25H38N2O7 and a molecular weight of 478.59 g/mol. Its IUPAC name is tert-butyl 2-[cyclopropyl-[1-[4-hydroxy-3-(3-methoxypropoxy)phenyl]ethyl]carbamoyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl 2-[cyclopropyl-[1-[4-hydroxy-3-(3-methoxypropoxy)phenyl]ethyl]carbamoyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 77474708 |
| Molecular Formula | C25H38N2O7 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.27 |
| IUPAC Name | tert-butyl 2-[cyclopropyl-[1-[4-hydroxy-3-(3-methoxypropoxy)phenyl]ethyl]carbamoyl]morpholine-4-carboxylate |
| SMILES | COCCCOc1cc(C(C)N(C(=O)C2CN(C(=O)OC(C)(C)C)CCO2)C2CC2)ccc1O |
| InChI | InChI=1S/C25H38N2O7/c1-17(18-7-10-20(28)21(15-18)32-13-6-12-31-5)27(19-8-9-19)23(29)22-16-26(11-14-33-22)24(30)34-25(2,3)4/h7,10,15,17,19,22,28H,6,8-9,11-14,16H2,1-5H3 |
| InChIKey | LMZXCZRQKPYGEI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|