C18H14Cl2N2O — CID 7747856
3-[(2,6-dichlorophenyl)methyl]-2-methyl-6-phenylpyrimidin-4-one (PubChem CID 7747856) has the molecular formula C18H14Cl2N2O and a molecular weight of 345.23 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-2-methyl-6-phenylpyrimidin-4-one.
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-2-methyl-6-phenylpyrimidin-4-one |
|---|---|
| PubChem CID | 7747856 |
| Molecular Formula | C18H14Cl2N2O |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-2-methyl-6-phenylpyrimidin-4-one |
| SMILES | Cc1nc(-c2ccccc2)cc(=O)n1Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H14Cl2N2O/c1-12-21-17(13-6-3-2-4-7-13)10-18(23)22(12)11-14-15(19)8-5-9-16(14)20/h2-10H,11H2,1H3 |
| InChIKey | KMZRHLUXSLCHOR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |