C26H24N2OS — CID 7748815
3-[(4-methylphenyl)methyl]-6-phenyl-2-(2-phenylethylsulfanyl)pyrimidin-4-one (PubChem CID 7748815) has the molecular formula C26H24N2OS and a molecular weight of 412.56 g/mol. Its IUPAC name is 3-[(4-methylphenyl)methyl]-6-phenyl-2-(2-phenylethylsulfanyl)pyrimidin-4-one.
| Compound Name | 3-[(4-methylphenyl)methyl]-6-phenyl-2-(2-phenylethylsulfanyl)pyrimidin-4-one |
|---|---|
| PubChem CID | 7748815 |
| Molecular Formula | C26H24N2OS |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 3-[(4-methylphenyl)methyl]-6-phenyl-2-(2-phenylethylsulfanyl)pyrimidin-4-one |
| SMILES | Cc1ccc(Cn2c(SCCc3ccccc3)nc(-c3ccccc3)cc2=O)cc1 |
| InChI | InChI=1S/C26H24N2OS/c1-20-12-14-22(15-13-20)19-28-25(29)18-24(23-10-6-3-7-11-23)27-26(28)30-17-16-21-8-4-2-5-9-21/h2-15,18H,16-17,19H2,1H3 |
| InChIKey | KHQKUASKWMNTMZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |