C19H20N2O3S — CID 46886544
3-benzyl-2-(3,3-dihydroxypropylsulfanyl)-6-methylquinazolin-4-one (PubChem CID 46886544) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 3-benzyl-2-(3,3-dihydroxypropylsulfanyl)-6-methylquinazolin-4-one.
| Compound Name | 3-benzyl-2-(3,3-dihydroxypropylsulfanyl)-6-methylquinazolin-4-one |
|---|---|
| PubChem CID | 46886544 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 3-benzyl-2-(3,3-dihydroxypropylsulfanyl)-6-methylquinazolin-4-one |
| SMILES | Cc1ccc2nc(SCCC(O)O)n(Cc3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C19H20N2O3S/c1-13-7-8-16-15(11-13)18(24)21(12-14-5-3-2-4-6-14)19(20-16)25-10-9-17(22)23/h2-8,11,17,22-23H,9-10,12H2,1H3 |
| InChIKey | IOCLXLBMQHJBJH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|