C18H21N3O4S — CID 7748146
propyl 4-[[2-(4-methyl-2-methylsulfanyl-6-oxopyrimidin-1-yl)acetyl]amino]benzoate (PubChem CID 7748146) has the molecular formula C18H21N3O4S and a molecular weight of 375.45 g/mol. Its IUPAC name is propyl 4-[[2-(4-methyl-2-methylsulfanyl-6-oxopyrimidin-1-yl)acetyl]amino]benzoate.
| Compound Name | propyl 4-[[2-(4-methyl-2-methylsulfanyl-6-oxopyrimidin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7748146 |
| Molecular Formula | C18H21N3O4S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | propyl 4-[[2-(4-methyl-2-methylsulfanyl-6-oxopyrimidin-1-yl)acetyl]amino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=O)Cn2c(SC)nc(C)cc2=O)cc1 |
| InChI | InChI=1S/C18H21N3O4S/c1-4-9-25-17(24)13-5-7-14(8-6-13)20-15(22)11-21-16(23)10-12(2)19-18(21)26-3/h5-8,10H,4,9,11H2,1-3H3,(H,20,22) |
| InChIKey | JPSNGJZXUWKASS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |