C21H25N3O2 — CID 77486526
3H-benzimidazol-5-yl-[5-(2-methoxyprop-1-enyl)-6-methyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-1-yl]methanone (PubChem CID 77486526) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3H-benzimidazol-5-yl-[5-(2-methoxyprop-1-enyl)-6-methyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-1-yl]methanone.
| Compound Name | 3H-benzimidazol-5-yl-[5-(2-methoxyprop-1-enyl)-6-methyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-1-yl]methanone |
|---|---|
| PubChem CID | 77486526 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 3H-benzimidazol-5-yl-[5-(2-methoxyprop-1-enyl)-6-methyl-2,3,4,4a,7,7a-hexahydrocyclopenta[b]pyridin-1-yl]methanone |
| SMILES | COC(C)=CC1=C(C)CC2C1CCCN2C(=O)c1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C21H25N3O2/c1-13-9-20-16(17(13)10-14(2)26-3)5-4-8-24(20)21(25)15-6-7-18-19(11-15)23-12-22-18/h6-7,10-12,16,20H,4-5,8-9H2,1-3H3,(H,22,23) |
| InChIKey | IDEJGBGGFCBNOI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|