C10H11F4NO — CID 77492759
1-[4-fluoro-2-(trifluoromethyl)phenoxy]propan-2-amine (PubChem CID 77492759) has the molecular formula C10H11F4NO and a molecular weight of 237.20 g/mol. Its IUPAC name is 1-[4-fluoro-2-(trifluoromethyl)phenoxy]propan-2-amine.
| Compound Name | 1-[4-fluoro-2-(trifluoromethyl)phenoxy]propan-2-amine |
|---|---|
| PubChem CID | 77492759 |
| Molecular Formula | C10H11F4NO |
| Molecular Weight | 237.20 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 1-[4-fluoro-2-(trifluoromethyl)phenoxy]propan-2-amine |
| SMILES | CC(N)COc1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H11F4NO/c1-6(15)5-16-9-3-2-7(11)4-8(9)10(12,13)14/h2-4,6H,5,15H2,1H3 |
| InChIKey | TZUMNPUJGPLFAY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |