C26H37N5O6S — CID 77495762
14-anilino-N-(dimethylsulfamoyl)-18-hydroxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide (PubChem CID 77495762) has the molecular formula C26H37N5O6S and a molecular weight of 547.68 g/mol. Its IUPAC name is 14-anilino-N-(dimethylsulfamoyl)-18-hydroxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide.
| Compound Name | 14-anilino-N-(dimethylsulfamoyl)-18-hydroxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
|---|---|
| PubChem CID | 77495762 |
| Molecular Formula | C26H37N5O6S |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.25 |
| IUPAC Name | 14-anilino-N-(dimethylsulfamoyl)-18-hydroxy-2,15-dioxo-3,16-diazatricyclo[14.3.0.04,6]nonadec-7-ene-4-carboxamide |
| SMILES | CN(C)S(=O)(=O)NC(=O)C12CC1C=CCCCCCC(Nc1ccccc1)C(=O)N1CC(O)CC1C(=O)N2 |
| InChI | InChI=1S/C26H37N5O6S/c1-30(2)38(36,37)29-25(35)26-16-18(26)11-7-4-3-5-10-14-21(27-19-12-8-6-9-13-19)24(34)31-17-20(32)15-22(31)23(33)28-26/h6-9,11-13,18,20-22,27,32H,3-5,10,14-17H2,1-2H3,(H,28,33)(H,29,35) |
| InChIKey | IGHYXCCEVVRTDF-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 148.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|